C23H31N3O3 — CID 25292513
N-[2-[[3-[(2S)-3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropoxy]phenyl]methylamino]ethyl]acetamide (PubChem CID 25292513) has the molecular formula C23H31N3O3 and a molecular weight of 397.52 g/mol. Its IUPAC name is N-[2-[[3-[(2S)-3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropoxy]phenyl]methylamino]ethyl]acetamide.
| Compound Name | N-[2-[[3-[(2S)-3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropoxy]phenyl]methylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 25292513 |
| Molecular Formula | C23H31N3O3 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | N-[2-[[3-[(2S)-3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropoxy]phenyl]methylamino]ethyl]acetamide |
| SMILES | CC(=O)NCCNCc1cccc(OC[C@@H](O)CN2CCc3ccccc3C2)c1 |
| InChI | InChI=1S/C23H31N3O3/c1-18(27)25-11-10-24-14-19-5-4-8-23(13-19)29-17-22(28)16-26-12-9-20-6-2-3-7-21(20)15-26/h2-8,13,22,24,28H,9-12,14-17H2,1H3,(H,25,27)/t22-/m0/s1 |
| InChIKey | VMNDUGDKANMFMX-QFIPXVFZSA-N |
| XLogP | 1.71 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|