C25H35N3O3 — CID 29028407
(2R)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-3-[3-[(2-morpholin-4-ylethylamino)methyl]phenoxy]propan-2-ol (PubChem CID 29028407) has the molecular formula C25H35N3O3 and a molecular weight of 425.57 g/mol. Its IUPAC name is (2R)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-3-[3-[(2-morpholin-4-ylethylamino)methyl]phenoxy]propan-2-ol.
| Compound Name | (2R)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-3-[3-[(2-morpholin-4-ylethylamino)methyl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 29028407 |
| Molecular Formula | C25H35N3O3 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.27 |
| IUPAC Name | (2R)-1-(3,4-dihydro-1H-isoquinolin-2-yl)-3-[3-[(2-morpholin-4-ylethylamino)methyl]phenoxy]propan-2-ol |
| SMILES | O[C@@H](COc1cccc(CNCCN2CCOCC2)c1)CN1CCc2ccccc2C1 |
| InChI | InChI=1S/C25H35N3O3/c29-24(19-28-10-8-22-5-1-2-6-23(22)18-28)20-31-25-7-3-4-21(16-25)17-26-9-11-27-12-14-30-15-13-27/h1-7,16,24,26,29H,8-15,17-20H2/t24-/m1/s1 |
| InChIKey | DVLJAOGQWHUWGC-XMMPIXPASA-N |
| XLogP | 1.91 |
| TPSA | 57.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|