C22H29N5O3 — CID 28957196
(2R)-1-[3-[(2-imidazo[1,2-a]pyrimidin-2-ylethylamino)methyl]phenoxy]-3-morpholin-4-ylpropan-2-ol (PubChem CID 28957196) has the molecular formula C22H29N5O3 and a molecular weight of 411.51 g/mol. Its IUPAC name is (2R)-1-[3-[(2-imidazo[1,2-a]pyrimidin-2-ylethylamino)methyl]phenoxy]-3-morpholin-4-ylpropan-2-ol.
| Compound Name | (2R)-1-[3-[(2-imidazo[1,2-a]pyrimidin-2-ylethylamino)methyl]phenoxy]-3-morpholin-4-ylpropan-2-ol |
|---|---|
| PubChem CID | 28957196 |
| Molecular Formula | C22H29N5O3 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | (2R)-1-[3-[(2-imidazo[1,2-a]pyrimidin-2-ylethylamino)methyl]phenoxy]-3-morpholin-4-ylpropan-2-ol |
| SMILES | O[C@@H](COc1cccc(CNCCc2cn3cccnc3n2)c1)CN1CCOCC1 |
| InChI | InChI=1S/C22H29N5O3/c28-20(16-26-9-11-29-12-10-26)17-30-21-4-1-3-18(13-21)14-23-7-5-19-15-27-8-2-6-24-22(27)25-19/h1-4,6,8,13,15,20,23,28H,5,7,9-12,14,16-17H2/t20-/m1/s1 |
| InChIKey | JOLBTSFZCZURTF-HXUWFJFHSA-N |
| XLogP | 1.13 |
| TPSA | 84.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|