C21H34N2O3 — CID 72839922
1-(azepan-1-yl)-3-[3-(1,4-oxazepan-4-ylmethyl)phenoxy]propan-2-ol (PubChem CID 72839922) has the molecular formula C21H34N2O3 and a molecular weight of 362.51 g/mol. Its IUPAC name is 1-(azepan-1-yl)-3-[3-(1,4-oxazepan-4-ylmethyl)phenoxy]propan-2-ol.
| Compound Name | 1-(azepan-1-yl)-3-[3-(1,4-oxazepan-4-ylmethyl)phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 72839922 |
| Molecular Formula | C21H34N2O3 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.26 |
| IUPAC Name | 1-(azepan-1-yl)-3-[3-(1,4-oxazepan-4-ylmethyl)phenoxy]propan-2-ol |
| SMILES | OC(COc1cccc(CN2CCCOCC2)c1)CN1CCCCCC1 |
| InChI | InChI=1S/C21H34N2O3/c24-20(17-22-9-3-1-2-4-10-22)18-26-21-8-5-7-19(15-21)16-23-11-6-13-25-14-12-23/h5,7-8,15,20,24H,1-4,6,9-14,16-18H2 |
| InChIKey | VBMZMIRKSYZZHV-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |