C21H33FN2O2 — CID 97285581
(2S)-1-(azepan-1-yl)-3-[3-[(4-fluoropiperidin-1-yl)methyl]phenoxy]propan-2-ol (PubChem CID 97285581) has the molecular formula C21H33FN2O2 and a molecular weight of 364.51 g/mol. Its IUPAC name is (2S)-1-(azepan-1-yl)-3-[3-[(4-fluoropiperidin-1-yl)methyl]phenoxy]propan-2-ol.
| Compound Name | (2S)-1-(azepan-1-yl)-3-[3-[(4-fluoropiperidin-1-yl)methyl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 97285581 |
| Molecular Formula | C21H33FN2O2 |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.25 |
| IUPAC Name | (2S)-1-(azepan-1-yl)-3-[3-[(4-fluoropiperidin-1-yl)methyl]phenoxy]propan-2-ol |
| SMILES | O[C@H](COc1cccc(CN2CCC(F)CC2)c1)CN1CCCCCC1 |
| InChI | InChI=1S/C21H33FN2O2/c22-19-8-12-24(13-9-19)15-18-6-5-7-21(14-18)26-17-20(25)16-23-10-3-1-2-4-11-23/h5-7,14,19-20,25H,1-4,8-13,15-17H2/t20-/m0/s1 |
| InChIKey | JOBQXZBZJGBZSN-FQEVSTJZSA-N |
| XLogP | 3.24 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |