C20H26N4O3 — CID 123697580
2-[(2-amino-3-pyridinyl)oxy]-3-[[3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropyl]amino]propanal (PubChem CID 123697580) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is 2-[(2-amino-3-pyridinyl)oxy]-3-[[3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropyl]amino]propanal.
| Compound Name | 2-[(2-amino-3-pyridinyl)oxy]-3-[[3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropyl]amino]propanal |
|---|---|
| PubChem CID | 123697580 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 2-[(2-amino-3-pyridinyl)oxy]-3-[[3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropyl]amino]propanal |
| SMILES | Nc1ncccc1OC(C=O)CNCC(O)CN1CCc2ccccc2C1 |
| InChI | InChI=1S/C20H26N4O3/c21-20-19(6-3-8-23-20)27-18(14-25)11-22-10-17(26)13-24-9-7-15-4-1-2-5-16(15)12-24/h1-6,8,14,17-18,22,26H,7,9-13H2,(H2,21,23) |
| InChIKey | QMLOOXDEWLUMHN-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 100.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|