C18H24N4O2 — CID 139435385
(Z)-4-amino-N-[(2R)-3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropyl]-2-ethenyliminobut-3-enamide (PubChem CID 139435385) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is (Z)-4-amino-N-[(2R)-3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropyl]-2-ethenyliminobut-3-enamide.
| Compound Name | (Z)-4-amino-N-[(2R)-3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropyl]-2-ethenyliminobut-3-enamide |
|---|---|
| PubChem CID | 139435385 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | (Z)-4-amino-N-[(2R)-3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropyl]-2-ethenyliminobut-3-enamide |
| SMILES | C=C/N=C(/C=C\N)C(=O)NC[C@@H](O)CN1CCc2ccccc2C1 |
| InChI | InChI=1S/C18H24N4O2/c1-2-20-17(7-9-19)18(24)21-11-16(23)13-22-10-8-14-5-3-4-6-15(14)12-22/h2-7,9,16,23H,1,8,10-13,19H2,(H,21,24)/b9-7-,20-17-/t16-/m1/s1 |
| InChIKey | BVLFPZNIZIENTH-CBIXDWRWSA-N |
| XLogP | 0.58 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|