C20H25N3O2 — CID 126546041
(3Z)-N-[(2S)-3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropyl]-2-ethenyliminohexa-3,5-dienamide (PubChem CID 126546041) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is (3Z)-N-[(2S)-3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropyl]-2-ethenyliminohexa-3,5-dienamide.
| Compound Name | (3Z)-N-[(2S)-3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropyl]-2-ethenyliminohexa-3,5-dienamide |
|---|---|
| PubChem CID | 126546041 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | (3Z)-N-[(2S)-3-(3,4-dihydro-1H-isoquinolin-2-yl)-2-hydroxypropyl]-2-ethenyliminohexa-3,5-dienamide |
| SMILES | C=C/C=C\C(=N/C=C)C(=O)NC[C@H](O)CN1CCc2ccccc2C1 |
| InChI | InChI=1S/C20H25N3O2/c1-3-5-10-19(21-4-2)20(25)22-13-18(24)15-23-12-11-16-8-6-7-9-17(16)14-23/h3-10,18,24H,1-2,11-15H2,(H,22,25)/b10-5-,21-19+/t18-/m0/s1 |
| InChIKey | ANDLVGYHYRSNOR-LKHLUNLCSA-N |
| XLogP | 1.85 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|