C17H18ClNO — CID 39389983
(1R)-1-(3-chlorophenyl)-2-(3,4-dihydro-1H-isoquinolin-2-yl)ethanol (PubChem CID 39389983) has the molecular formula C17H18ClNO and a molecular weight of 287.79 g/mol. Its IUPAC name is (1R)-1-(3-chlorophenyl)-2-(3,4-dihydro-1H-isoquinolin-2-yl)ethanol.
| Compound Name | (1R)-1-(3-chlorophenyl)-2-(3,4-dihydro-1H-isoquinolin-2-yl)ethanol |
|---|---|
| PubChem CID | 39389983 |
| Molecular Formula | C17H18ClNO |
| Molecular Weight | 287.79 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | (1R)-1-(3-chlorophenyl)-2-(3,4-dihydro-1H-isoquinolin-2-yl)ethanol |
| SMILES | O[C@@H](CN1CCc2ccccc2C1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H18ClNO/c18-16-7-3-6-14(10-16)17(20)12-19-9-8-13-4-1-2-5-15(13)11-19/h1-7,10,17,20H,8-9,11-12H2/t17-/m0/s1 |
| InChIKey | IIAQFDWFGNKXGA-KRWDZBQOSA-N |
| XLogP | 3.43 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.79 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |