C15H23ClN2O3S — CID 71986979
N-[1-[2-(3-chlorophenyl)-2-hydroxyethyl]piperidin-4-yl]-N-methylmethanesulfonamide (PubChem CID 71986979) has the molecular formula C15H23ClN2O3S and a molecular weight of 346.88 g/mol. Its IUPAC name is N-[1-[2-(3-chlorophenyl)-2-hydroxyethyl]piperidin-4-yl]-N-methylmethanesulfonamide.
| Compound Name | N-[1-[2-(3-chlorophenyl)-2-hydroxyethyl]piperidin-4-yl]-N-methylmethanesulfonamide |
|---|---|
| PubChem CID | 71986979 |
| Molecular Formula | C15H23ClN2O3S |
| Molecular Weight | 346.88 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | N-[1-[2-(3-chlorophenyl)-2-hydroxyethyl]piperidin-4-yl]-N-methylmethanesulfonamide |
| SMILES | CN(C1CCN(CC(O)c2cccc(Cl)c2)CC1)S(C)(=O)=O |
| InChI | InChI=1S/C15H23ClN2O3S/c1-17(22(2,20)21)14-6-8-18(9-7-14)11-15(19)12-4-3-5-13(16)10-12/h3-5,10,14-15,19H,6-9,11H2,1-2H3 |
| InChIKey | QTNYSLSPODDMLB-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.88 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |