C15H23BrN2O — CID 110898476
1-(3-bromophenyl)-2-[4-(dimethylamino)piperidin-1-yl]ethanol (PubChem CID 110898476) has the molecular formula C15H23BrN2O and a molecular weight of 327.27 g/mol. Its IUPAC name is 1-(3-bromophenyl)-2-[4-(dimethylamino)piperidin-1-yl]ethanol.
| Compound Name | 1-(3-bromophenyl)-2-[4-(dimethylamino)piperidin-1-yl]ethanol |
|---|---|
| PubChem CID | 110898476 |
| Molecular Formula | C15H23BrN2O |
| Molecular Weight | 327.27 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 1-(3-bromophenyl)-2-[4-(dimethylamino)piperidin-1-yl]ethanol |
| SMILES | CN(C)C1CCN(CC(O)c2cccc(Br)c2)CC1 |
| InChI | InChI=1S/C15H23BrN2O/c1-17(2)14-6-8-18(9-7-14)11-15(19)12-4-3-5-13(16)10-12/h3-5,10,14-15,19H,6-9,11H2,1-2H3 |
| InChIKey | SZZZRYXHILPVHS-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.27 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |