C16H19Cl2N3O — CID 110019592
1-(3-chlorophenyl)-2-[4-(4-chloropyrazol-1-yl)piperidin-1-yl]ethanol (PubChem CID 110019592) has the molecular formula C16H19Cl2N3O and a molecular weight of 340.25 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-2-[4-(4-chloropyrazol-1-yl)piperidin-1-yl]ethanol.
| Compound Name | 1-(3-chlorophenyl)-2-[4-(4-chloropyrazol-1-yl)piperidin-1-yl]ethanol |
|---|---|
| PubChem CID | 110019592 |
| Molecular Formula | C16H19Cl2N3O |
| Molecular Weight | 340.25 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 1-(3-chlorophenyl)-2-[4-(4-chloropyrazol-1-yl)piperidin-1-yl]ethanol |
| SMILES | OC(CN1CCC(n2cc(Cl)cn2)CC1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H19Cl2N3O/c17-13-3-1-2-12(8-13)16(22)11-20-6-4-15(5-7-20)21-10-14(18)9-19-21/h1-3,8-10,15-16,22H,4-7,11H2 |
| InChIKey | UJLSOWWOZWTVDZ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.25 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |