C12H20ClN3O2 — CID 110019591
(2S)-1-[4-(4-chloropyrazol-1-yl)piperidin-1-yl]-3-methoxypropan-2-ol (PubChem CID 110019591) has the molecular formula C12H20ClN3O2 and a molecular weight of 273.76 g/mol. Its IUPAC name is (2S)-1-[4-(4-chloropyrazol-1-yl)piperidin-1-yl]-3-methoxypropan-2-ol.
| Compound Name | (2S)-1-[4-(4-chloropyrazol-1-yl)piperidin-1-yl]-3-methoxypropan-2-ol |
|---|---|
| PubChem CID | 110019591 |
| Molecular Formula | C12H20ClN3O2 |
| Molecular Weight | 273.76 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | (2S)-1-[4-(4-chloropyrazol-1-yl)piperidin-1-yl]-3-methoxypropan-2-ol |
| SMILES | COC[C@@H](O)CN1CCC(n2cc(Cl)cn2)CC1 |
| InChI | InChI=1S/C12H20ClN3O2/c1-18-9-12(17)8-15-4-2-11(3-5-15)16-7-10(13)6-14-16/h6-7,11-12,17H,2-5,8-9H2,1H3/t12-/m0/s1 |
| InChIKey | PRHNBEJCYHYTOL-LBPRGKRZSA-N |
| XLogP | 1.18 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.76 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |