C17H25ClN2O2 — CID 111487644
1-[2-(3-chlorophenyl)-2-hydroxyethyl]-N-propan-2-ylpiperidine-4-carboxamide (PubChem CID 111487644) has the molecular formula C17H25ClN2O2 and a molecular weight of 324.85 g/mol. Its IUPAC name is 1-[2-(3-chlorophenyl)-2-hydroxyethyl]-N-propan-2-ylpiperidine-4-carboxamide.
| Compound Name | 1-[2-(3-chlorophenyl)-2-hydroxyethyl]-N-propan-2-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 111487644 |
| Molecular Formula | C17H25ClN2O2 |
| Molecular Weight | 324.85 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 1-[2-(3-chlorophenyl)-2-hydroxyethyl]-N-propan-2-ylpiperidine-4-carboxamide |
| SMILES | CC(C)NC(=O)C1CCN(CC(O)c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C17H25ClN2O2/c1-12(2)19-17(22)13-6-8-20(9-7-13)11-16(21)14-4-3-5-15(18)10-14/h3-5,10,12-13,16,21H,6-9,11H2,1-2H3,(H,19,22) |
| InChIKey | RDJJGBIFFUZIAJ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.85 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |