C20H29ClN2O2 — CID 95146791
1-[(2R)-2-(4-chlorophenyl)-2-hydroxyethyl]-N-cyclohexylpiperidine-4-carboxamide (PubChem CID 95146791) has the molecular formula C20H29ClN2O2 and a molecular weight of 364.92 g/mol. Its IUPAC name is 1-[(2R)-2-(4-chlorophenyl)-2-hydroxyethyl]-N-cyclohexylpiperidine-4-carboxamide.
| Compound Name | 1-[(2R)-2-(4-chlorophenyl)-2-hydroxyethyl]-N-cyclohexylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 95146791 |
| Molecular Formula | C20H29ClN2O2 |
| Molecular Weight | 364.92 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 1-[(2R)-2-(4-chlorophenyl)-2-hydroxyethyl]-N-cyclohexylpiperidine-4-carboxamide |
| SMILES | O=C(NC1CCCCC1)C1CCN(C[C@H](O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C20H29ClN2O2/c21-17-8-6-15(7-9-17)19(24)14-23-12-10-16(11-13-23)20(25)22-18-4-2-1-3-5-18/h6-9,16,18-19,24H,1-5,10-14H2,(H,22,25)/t19-/m0/s1 |
| InChIKey | BFZQPAVNYZXKKG-IBGZPJMESA-N |
| XLogP | 3.53 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.92 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |