C21H30ClFN2O — CID 45015159
1-[(2-chloro-6-fluorophenyl)methyl]-N-cyclooctylpiperidine-4-carboxamide (PubChem CID 45015159) has the molecular formula C21H30ClFN2O and a molecular weight of 380.94 g/mol. Its IUPAC name is 1-[(2-chloro-6-fluorophenyl)methyl]-N-cyclooctylpiperidine-4-carboxamide.
| Compound Name | 1-[(2-chloro-6-fluorophenyl)methyl]-N-cyclooctylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 45015159 |
| Molecular Formula | C21H30ClFN2O |
| Molecular Weight | 380.94 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 1-[(2-chloro-6-fluorophenyl)methyl]-N-cyclooctylpiperidine-4-carboxamide |
| SMILES | O=C(NC1CCCCCCC1)C1CCN(Cc2c(F)cccc2Cl)CC1 |
| InChI | InChI=1S/C21H30ClFN2O/c22-19-9-6-10-20(23)18(19)15-25-13-11-16(12-14-25)21(26)24-17-7-4-2-1-3-5-8-17/h6,9-10,16-17H,1-5,7-8,11-15H2,(H,24,26) |
| InChIKey | HIQICFIHHSWHQK-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.94 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |