C18H24ClFN2O — CID 25249332
[1-[(2-chloro-6-fluorophenyl)methyl]piperidin-4-yl]-piperidin-1-ylmethanone (PubChem CID 25249332) has the molecular formula C18H24ClFN2O and a molecular weight of 338.85 g/mol. Its IUPAC name is [1-[(2-chloro-6-fluorophenyl)methyl]piperidin-4-yl]-piperidin-1-ylmethanone.
| Compound Name | [1-[(2-chloro-6-fluorophenyl)methyl]piperidin-4-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 25249332 |
| Molecular Formula | C18H24ClFN2O |
| Molecular Weight | 338.85 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | [1-[(2-chloro-6-fluorophenyl)methyl]piperidin-4-yl]-piperidin-1-ylmethanone |
| SMILES | O=C(C1CCN(Cc2c(F)cccc2Cl)CC1)N1CCCCC1 |
| InChI | InChI=1S/C18H24ClFN2O/c19-16-5-4-6-17(20)15(16)13-21-11-7-14(8-12-21)18(23)22-9-2-1-3-10-22/h4-6,14H,1-3,7-13H2 |
| InChIKey | BWXKPWKLKWVXQL-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.85 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |