C18H25ClN2O — CID 25250006
[1-[(2-chlorophenyl)methyl]piperidin-4-yl]-piperidin-1-ylmethanone (PubChem CID 25250006) has the molecular formula C18H25ClN2O and a molecular weight of 320.86 g/mol. Its IUPAC name is [1-[(2-chlorophenyl)methyl]piperidin-4-yl]-piperidin-1-ylmethanone.
| Compound Name | [1-[(2-chlorophenyl)methyl]piperidin-4-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 25250006 |
| Molecular Formula | C18H25ClN2O |
| Molecular Weight | 320.86 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | [1-[(2-chlorophenyl)methyl]piperidin-4-yl]-piperidin-1-ylmethanone |
| SMILES | O=C(C1CCN(Cc2ccccc2Cl)CC1)N1CCCCC1 |
| InChI | InChI=1S/C18H25ClN2O/c19-17-7-3-2-6-16(17)14-20-12-8-15(9-13-20)18(22)21-10-4-1-5-11-21/h2-3,6-7,15H,1,4-5,8-14H2 |
| InChIKey | BPJBBXUQEYKSHV-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.86 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |