C20H28N2O6 — CID 44828315
[1-[(2-hydroxyphenyl)methyl]piperidin-4-yl]-piperidin-1-ylmethanone;oxalic acid (PubChem CID 44828315) has the molecular formula C20H28N2O6 and a molecular weight of 392.45 g/mol. Its IUPAC name is [1-[(2-hydroxyphenyl)methyl]piperidin-4-yl]-piperidin-1-ylmethanone;oxalic acid.
| Compound Name | [1-[(2-hydroxyphenyl)methyl]piperidin-4-yl]-piperidin-1-ylmethanone;oxalic acid |
|---|---|
| PubChem CID | 44828315 |
| Molecular Formula | C20H28N2O6 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | [1-[(2-hydroxyphenyl)methyl]piperidin-4-yl]-piperidin-1-ylmethanone;oxalic acid |
| SMILES | O=C(C1CCN(Cc2ccccc2O)CC1)N1CCCCC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C18H26N2O2.C2H2O4/c21-17-7-3-2-6-16(17)14-19-12-8-15(9-13-19)18(22)20-10-4-1-5-11-20;3-1(4)2(5)6/h2-3,6-7,15,21H,1,4-5,8-14H2;(H,3,4)(H,5,6) |
| InChIKey | VTFBODKRJLTUBW-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 118.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|