C18H27N2O2+ — CID 7297487
[1-[(2-hydroxyphenyl)methyl]piperidin-1-ium-4-yl]-piperidin-1-ylmethanone (PubChem CID 7297487) has the molecular formula C18H27N2O2+ and a molecular weight of 303.43 g/mol. Its IUPAC name is [1-[(2-hydroxyphenyl)methyl]piperidin-1-ium-4-yl]-piperidin-1-ylmethanone.
| Compound Name | [1-[(2-hydroxyphenyl)methyl]piperidin-1-ium-4-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 7297487 |
| Molecular Formula | C18H27N2O2+ |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.21 |
| IUPAC Name | [1-[(2-hydroxyphenyl)methyl]piperidin-1-ium-4-yl]-piperidin-1-ylmethanone |
| SMILES | O=C(C1CC[NH+](Cc2ccccc2O)CC1)N1CCCCC1 |
| InChI | InChI=1S/C18H26N2O2/c21-17-7-3-2-6-16(17)14-19-12-8-15(9-13-19)18(22)20-10-4-1-5-11-20/h2-3,6-7,15,21H,1,4-5,8-14H2/p+1 |
| InChIKey | KTNCKQREVLTMAU-UHFFFAOYSA-O |
| XLogP | 1.20 |
| TPSA | 44.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|