C21H30N3O+ — CID 4746245
azepan-1-yl-[1-(1H-indol-3-ylmethyl)piperidin-1-ium-3-yl]methanone (PubChem CID 4746245) has the molecular formula C21H30N3O+ and a molecular weight of 340.49 g/mol. Its IUPAC name is azepan-1-yl-[1-(1H-indol-3-ylmethyl)piperidin-1-ium-3-yl]methanone.
| Compound Name | azepan-1-yl-[1-(1H-indol-3-ylmethyl)piperidin-1-ium-3-yl]methanone |
|---|---|
| PubChem CID | 4746245 |
| Molecular Formula | C21H30N3O+ |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | azepan-1-yl-[1-(1H-indol-3-ylmethyl)piperidin-1-ium-3-yl]methanone |
| SMILES | O=C(C1CCC[NH+](Cc2c[nH]c3ccccc23)C1)N1CCCCCC1 |
| InChI | InChI=1S/C21H29N3O/c25-21(24-12-5-1-2-6-13-24)17-8-7-11-23(15-17)16-18-14-22-20-10-4-3-9-19(18)20/h3-4,9-10,14,17,22H,1-2,5-8,11-13,15-16H2/p+1 |
| InChIKey | JGFSFURNCWMKBO-UHFFFAOYSA-O |
| XLogP | 2.37 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |