C20H31N2O+ — CID 4746131
azepan-1-yl-[1-[(2-methylphenyl)methyl]piperidin-1-ium-3-yl]methanone (PubChem CID 4746131) has the molecular formula C20H31N2O+ and a molecular weight of 315.48 g/mol. Its IUPAC name is azepan-1-yl-[1-[(2-methylphenyl)methyl]piperidin-1-ium-3-yl]methanone.
| Compound Name | azepan-1-yl-[1-[(2-methylphenyl)methyl]piperidin-1-ium-3-yl]methanone |
|---|---|
| PubChem CID | 4746131 |
| Molecular Formula | C20H31N2O+ |
| Molecular Weight | 315.48 g/mol |
| Exact Mass | 315.24 |
| IUPAC Name | azepan-1-yl-[1-[(2-methylphenyl)methyl]piperidin-1-ium-3-yl]methanone |
| SMILES | Cc1ccccc1C[NH+]1CCCC(C(=O)N2CCCCCC2)C1 |
| InChI | InChI=1S/C20H30N2O/c1-17-9-4-5-10-18(17)15-21-12-8-11-19(16-21)20(23)22-13-6-2-3-7-14-22/h4-5,9-10,19H,2-3,6-8,11-16H2,1H3/p+1 |
| InChIKey | XSZADWPKCACZTJ-UHFFFAOYSA-O |
| XLogP | 2.19 |
| TPSA | 24.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.48 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |