C14H22NO+ — CID 6937809
[(3S)-1-[(2-methylphenyl)methyl]piperidin-1-ium-3-yl]methanol (PubChem CID 6937809) has the molecular formula C14H22NO+ and a molecular weight of 220.34 g/mol. Its IUPAC name is [(3S)-1-[(2-methylphenyl)methyl]piperidin-1-ium-3-yl]methanol.
| Compound Name | [(3S)-1-[(2-methylphenyl)methyl]piperidin-1-ium-3-yl]methanol |
|---|---|
| PubChem CID | 6937809 |
| Molecular Formula | C14H22NO+ |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.17 |
| IUPAC Name | [(3S)-1-[(2-methylphenyl)methyl]piperidin-1-ium-3-yl]methanol |
| SMILES | Cc1ccccc1C[NH+]1CCC[C@H](CO)C1 |
| InChI | InChI=1S/C14H21NO/c1-12-5-2-3-7-14(12)10-15-8-4-6-13(9-15)11-16/h2-3,5,7,13,16H,4,6,8-11H2,1H3/p+1/t13-/m0/s1 |
| InChIKey | GFKOAMVWDPCANK-ZDUSSCGKSA-O |
| XLogP | 0.78 |
| TPSA | 24.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |