C20H28NO3+ — CID 8547498
4-[[(3R)-3-(hydroxymethyl)piperidin-1-ium-1-yl]methyl]-7-methyl-6-propan-2-ylchromen-2-one (PubChem CID 8547498) has the molecular formula C20H28NO3+ and a molecular weight of 330.45 g/mol. Its IUPAC name is 4-[[(3R)-3-(hydroxymethyl)piperidin-1-ium-1-yl]methyl]-7-methyl-6-propan-2-ylchromen-2-one.
| Compound Name | 4-[[(3R)-3-(hydroxymethyl)piperidin-1-ium-1-yl]methyl]-7-methyl-6-propan-2-ylchromen-2-one |
|---|---|
| PubChem CID | 8547498 |
| Molecular Formula | C20H28NO3+ |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | 4-[[(3R)-3-(hydroxymethyl)piperidin-1-ium-1-yl]methyl]-7-methyl-6-propan-2-ylchromen-2-one |
| SMILES | Cc1cc2oc(=O)cc(C[NH+]3CCC[C@@H](CO)C3)c2cc1C(C)C |
| InChI | InChI=1S/C20H27NO3/c1-13(2)17-9-18-16(8-20(23)24-19(18)7-14(17)3)11-21-6-4-5-15(10-21)12-22/h7-9,13,15,22H,4-6,10-12H2,1-3H3/p+1/t15-/m1/s1 |
| InChIKey | ACDHAMFUAKREOX-OAHLLOKOSA-O |
| XLogP | 2.01 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|