C18H23N2O3+ — CID 9304739
(3S)-1-[(6,7-dimethyl-2-oxochromen-4-yl)methyl]piperidin-1-ium-3-carboxamide (PubChem CID 9304739) has the molecular formula C18H23N2O3+ and a molecular weight of 315.39 g/mol. Its IUPAC name is (3S)-1-[(6,7-dimethyl-2-oxochromen-4-yl)methyl]piperidin-1-ium-3-carboxamide.
| Compound Name | (3S)-1-[(6,7-dimethyl-2-oxochromen-4-yl)methyl]piperidin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 9304739 |
| Molecular Formula | C18H23N2O3+ |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | (3S)-1-[(6,7-dimethyl-2-oxochromen-4-yl)methyl]piperidin-1-ium-3-carboxamide |
| SMILES | Cc1cc2oc(=O)cc(C[NH+]3CCC[C@H](C(N)=O)C3)c2cc1C |
| InChI | InChI=1S/C18H22N2O3/c1-11-6-15-14(8-17(21)23-16(15)7-12(11)2)10-20-5-3-4-13(9-20)18(19)22/h6-8,13H,3-5,9-10H2,1-2H3,(H2,19,22)/p+1/t13-/m0/s1 |
| InChIKey | GUJOLHPZUWIGRC-ZDUSSCGKSA-O |
| XLogP | 0.69 |
| TPSA | 77.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|