C19H25NO3 — CID 109397687
4-[[(2-hydroxycyclopentyl)methyl-methylamino]methyl]-6,7-dimethylchromen-2-one (PubChem CID 109397687) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is 4-[[(2-hydroxycyclopentyl)methyl-methylamino]methyl]-6,7-dimethylchromen-2-one.
| Compound Name | 4-[[(2-hydroxycyclopentyl)methyl-methylamino]methyl]-6,7-dimethylchromen-2-one |
|---|---|
| PubChem CID | 109397687 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 4-[[(2-hydroxycyclopentyl)methyl-methylamino]methyl]-6,7-dimethylchromen-2-one |
| SMILES | Cc1cc2oc(=O)cc(CN(C)CC3CCCC3O)c2cc1C |
| InChI | InChI=1S/C19H25NO3/c1-12-7-16-15(9-19(22)23-18(16)8-13(12)2)11-20(3)10-14-5-4-6-17(14)21/h7-9,14,17,21H,4-6,10-11H2,1-3H3 |
| InChIKey | DIOCZEYSQQMOEV-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|