C21H25N3O3 — CID 50954633
4-[[(5-cyclobutyl-1,2,4-oxadiazol-3-yl)methyl-ethylamino]methyl]-6,7-dimethylchromen-2-one (PubChem CID 50954633) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is 4-[[(5-cyclobutyl-1,2,4-oxadiazol-3-yl)methyl-ethylamino]methyl]-6,7-dimethylchromen-2-one.
| Compound Name | 4-[[(5-cyclobutyl-1,2,4-oxadiazol-3-yl)methyl-ethylamino]methyl]-6,7-dimethylchromen-2-one |
|---|---|
| PubChem CID | 50954633 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 4-[[(5-cyclobutyl-1,2,4-oxadiazol-3-yl)methyl-ethylamino]methyl]-6,7-dimethylchromen-2-one |
| SMILES | CCN(Cc1noc(C2CCC2)n1)Cc1cc(=O)oc2cc(C)c(C)cc12 |
| InChI | InChI=1S/C21H25N3O3/c1-4-24(12-19-22-21(27-23-19)15-6-5-7-15)11-16-10-20(25)26-18-9-14(3)13(2)8-17(16)18/h8-10,15H,4-7,11-12H2,1-3H3 |
| InChIKey | VCJPSCHSHUJNOC-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 72.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|