C25H27NO4 — CID 34941219
4-[[1,3-benzodioxol-5-ylmethyl(cyclopentyl)amino]methyl]-6,7-dimethylchromen-2-one (PubChem CID 34941219) has the molecular formula C25H27NO4 and a molecular weight of 405.49 g/mol. Its IUPAC name is 4-[[1,3-benzodioxol-5-ylmethyl(cyclopentyl)amino]methyl]-6,7-dimethylchromen-2-one.
| Compound Name | 4-[[1,3-benzodioxol-5-ylmethyl(cyclopentyl)amino]methyl]-6,7-dimethylchromen-2-one |
|---|---|
| PubChem CID | 34941219 |
| Molecular Formula | C25H27NO4 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | 4-[[1,3-benzodioxol-5-ylmethyl(cyclopentyl)amino]methyl]-6,7-dimethylchromen-2-one |
| SMILES | Cc1cc2oc(=O)cc(CN(Cc3ccc4c(c3)OCO4)C3CCCC3)c2cc1C |
| InChI | InChI=1S/C25H27NO4/c1-16-9-21-19(12-25(27)30-23(21)10-17(16)2)14-26(20-5-3-4-6-20)13-18-7-8-22-24(11-18)29-15-28-22/h7-12,20H,3-6,13-15H2,1-2H3 |
| InChIKey | RQCMTJODNPKZLP-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|