C15H19NO4 — CID 62027413
ethyl 2-[1,3-benzodioxol-5-ylmethyl(cyclopropyl)amino]acetate (PubChem CID 62027413) has the molecular formula C15H19NO4 and a molecular weight of 277.32 g/mol. Its IUPAC name is ethyl 2-[1,3-benzodioxol-5-ylmethyl(cyclopropyl)amino]acetate.
| Compound Name | ethyl 2-[1,3-benzodioxol-5-ylmethyl(cyclopropyl)amino]acetate |
|---|---|
| PubChem CID | 62027413 |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | ethyl 2-[1,3-benzodioxol-5-ylmethyl(cyclopropyl)amino]acetate |
| SMILES | CCOC(=O)CN(Cc1ccc2c(c1)OCO2)C1CC1 |
| InChI | InChI=1S/C15H19NO4/c1-2-18-15(17)9-16(12-4-5-12)8-11-3-6-13-14(7-11)20-10-19-13/h3,6-7,12H,2,4-5,8-10H2,1H3 |
| InChIKey | RQQGVPIXVMMMHA-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |