C19H26NO2+ — CID 8875827
cyclopentyl-[(6,7-dimethyl-2-oxochromen-4-yl)methyl]-dimethylazanium (PubChem CID 8875827) has the molecular formula C19H26NO2+ and a molecular weight of 300.42 g/mol. Its IUPAC name is cyclopentyl-[(6,7-dimethyl-2-oxochromen-4-yl)methyl]-dimethylazanium.
| Compound Name | cyclopentyl-[(6,7-dimethyl-2-oxochromen-4-yl)methyl]-dimethylazanium |
|---|---|
| PubChem CID | 8875827 |
| Molecular Formula | C19H26NO2+ |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | cyclopentyl-[(6,7-dimethyl-2-oxochromen-4-yl)methyl]-dimethylazanium |
| SMILES | Cc1cc2oc(=O)cc(C[N+](C)(C)C3CCCC3)c2cc1C |
| InChI | InChI=1S/C19H26NO2/c1-13-9-17-15(11-19(21)22-18(17)10-14(13)2)12-20(3,4)16-7-5-6-8-16/h9-11,16H,5-8,12H2,1-4H3/q+1 |
| InChIKey | HBNXRIPCMSCJSA-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|