C22H26NO3S+ — CID 9055500
(6,7-dimethyl-2-oxochromen-4-yl)methyl-[[(2R)-oxolan-2-yl]methyl]-(thiophen-2-ylmethyl)azanium (PubChem CID 9055500) has the molecular formula C22H26NO3S+ and a molecular weight of 384.52 g/mol. Its IUPAC name is (6,7-dimethyl-2-oxochromen-4-yl)methyl-[[(2R)-oxolan-2-yl]methyl]-(thiophen-2-ylmethyl)azanium.
| Compound Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl-[[(2R)-oxolan-2-yl]methyl]-(thiophen-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 9055500 |
| Molecular Formula | C22H26NO3S+ |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | (6,7-dimethyl-2-oxochromen-4-yl)methyl-[[(2R)-oxolan-2-yl]methyl]-(thiophen-2-ylmethyl)azanium |
| SMILES | Cc1cc2oc(=O)cc(C[NH+](Cc3cccs3)C[C@H]3CCCO3)c2cc1C |
| InChI | InChI=1S/C22H25NO3S/c1-15-9-20-17(11-22(24)26-21(20)10-16(15)2)12-23(13-18-5-3-7-25-18)14-19-6-4-8-27-19/h4,6,8-11,18H,3,5,7,12-14H2,1-2H3/p+1/t18-/m1/s1 |
| InChIKey | ACTXXFSUSXMMQD-GOSISDBHSA-O |
| XLogP | 3.24 |
| TPSA | 43.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|