C20H22NO4S+ — CID 9055454
(7-hydroxy-2-oxochromen-4-yl)methyl-[[(2S)-oxolan-2-yl]methyl]-(thiophen-2-ylmethyl)azanium (PubChem CID 9055454) has the molecular formula C20H22NO4S+ and a molecular weight of 372.47 g/mol. Its IUPAC name is (7-hydroxy-2-oxochromen-4-yl)methyl-[[(2S)-oxolan-2-yl]methyl]-(thiophen-2-ylmethyl)azanium.
| Compound Name | (7-hydroxy-2-oxochromen-4-yl)methyl-[[(2S)-oxolan-2-yl]methyl]-(thiophen-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 9055454 |
| Molecular Formula | C20H22NO4S+ |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | (7-hydroxy-2-oxochromen-4-yl)methyl-[[(2S)-oxolan-2-yl]methyl]-(thiophen-2-ylmethyl)azanium |
| SMILES | O=c1cc(C[NH+](Cc2cccs2)C[C@@H]2CCCO2)c2ccc(O)cc2o1 |
| InChI | InChI=1S/C20H21NO4S/c22-15-5-6-18-14(9-20(23)25-19(18)10-15)11-21(12-16-3-1-7-24-16)13-17-4-2-8-26-17/h2,4-6,8-10,16,22H,1,3,7,11-13H2/p+1/t16-/m0/s1 |
| InChIKey | KZOOSJTWJBPMHW-INIZCTEOSA-O |
| XLogP | 2.32 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|