C18H19ClNO2S+ — CID 8718421
(6-chloro-7-methyl-2-oxochromen-4-yl)methyl-ethyl-(thiophen-2-ylmethyl)azanium (PubChem CID 8718421) has the molecular formula C18H19ClNO2S+ and a molecular weight of 348.88 g/mol. Its IUPAC name is (6-chloro-7-methyl-2-oxochromen-4-yl)methyl-ethyl-(thiophen-2-ylmethyl)azanium.
| Compound Name | (6-chloro-7-methyl-2-oxochromen-4-yl)methyl-ethyl-(thiophen-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 8718421 |
| Molecular Formula | C18H19ClNO2S+ |
| Molecular Weight | 348.88 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | (6-chloro-7-methyl-2-oxochromen-4-yl)methyl-ethyl-(thiophen-2-ylmethyl)azanium |
| SMILES | CC[NH+](Cc1cccs1)Cc1cc(=O)oc2cc(C)c(Cl)cc12 |
| InChI | InChI=1S/C18H18ClNO2S/c1-3-20(11-14-5-4-6-23-14)10-13-8-18(21)22-17-7-12(2)16(19)9-15(13)17/h4-9H,3,10-11H2,1-2H3/p+1 |
| InChIKey | QJHPHCCXRXOWFN-UHFFFAOYSA-O |
| XLogP | 3.42 |
| TPSA | 34.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.88 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|