C21H24NO4S+ — CID 9055436
(7-methoxy-2-oxochromen-4-yl)methyl-[[(2R)-oxolan-2-yl]methyl]-(thiophen-2-ylmethyl)azanium (PubChem CID 9055436) has the molecular formula C21H24NO4S+ and a molecular weight of 386.49 g/mol. Its IUPAC name is (7-methoxy-2-oxochromen-4-yl)methyl-[[(2R)-oxolan-2-yl]methyl]-(thiophen-2-ylmethyl)azanium.
| Compound Name | (7-methoxy-2-oxochromen-4-yl)methyl-[[(2R)-oxolan-2-yl]methyl]-(thiophen-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 9055436 |
| Molecular Formula | C21H24NO4S+ |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | (7-methoxy-2-oxochromen-4-yl)methyl-[[(2R)-oxolan-2-yl]methyl]-(thiophen-2-ylmethyl)azanium |
| SMILES | COc1ccc2c(C[NH+](Cc3cccs3)C[C@H]3CCCO3)cc(=O)oc2c1 |
| InChI | InChI=1S/C21H23NO4S/c1-24-16-6-7-19-15(10-21(23)26-20(19)11-16)12-22(13-17-4-2-8-25-17)14-18-5-3-9-27-18/h3,5-7,9-11,17H,2,4,8,12-14H2,1H3/p+1/t17-/m1/s1 |
| InChIKey | PXRSKYKVTWJXQH-QGZVFWFLSA-O |
| XLogP | 2.63 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|