C19H22NO3S+ — CID 9134817
(7-methoxy-2-oxochromen-4-yl)methyl-[(1R)-2-methyl-1-thiophen-2-ylpropyl]azanium (PubChem CID 9134817) has the molecular formula C19H22NO3S+ and a molecular weight of 344.46 g/mol. Its IUPAC name is (7-methoxy-2-oxochromen-4-yl)methyl-[(1R)-2-methyl-1-thiophen-2-ylpropyl]azanium.
| Compound Name | (7-methoxy-2-oxochromen-4-yl)methyl-[(1R)-2-methyl-1-thiophen-2-ylpropyl]azanium |
|---|---|
| PubChem CID | 9134817 |
| Molecular Formula | C19H22NO3S+ |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | (7-methoxy-2-oxochromen-4-yl)methyl-[(1R)-2-methyl-1-thiophen-2-ylpropyl]azanium |
| SMILES | COc1ccc2c(C[NH2+][C@@H](c3cccs3)C(C)C)cc(=O)oc2c1 |
| InChI | InChI=1S/C19H21NO3S/c1-12(2)19(17-5-4-8-24-17)20-11-13-9-18(21)23-16-10-14(22-3)6-7-15(13)16/h4-10,12,19-20H,11H2,1-3H3/p+1/t19-/m1/s1 |
| InChIKey | FWKOMMQIZDIKMP-LJQANCHMSA-O |
| XLogP | 3.32 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|