C18H15BrO4 — CID 139845956
4-(bromomethyl)-7-methoxychromen-2-one;cyclohepta-2,4,6-trien-1-one (PubChem CID 139845956) has the molecular formula C18H15BrO4 and a molecular weight of 375.22 g/mol. Its IUPAC name is 4-(bromomethyl)-7-methoxychromen-2-one;cyclohepta-2,4,6-trien-1-one.
| Compound Name | 4-(bromomethyl)-7-methoxychromen-2-one;cyclohepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 139845956 |
| Molecular Formula | C18H15BrO4 |
| Molecular Weight | 375.22 g/mol |
| Exact Mass | 374.02 |
| IUPAC Name | 4-(bromomethyl)-7-methoxychromen-2-one;cyclohepta-2,4,6-trien-1-one |
| SMILES | COc1ccc2c(CBr)cc(=O)oc2c1.O=c1cccccc1 |
| InChI | InChI=1S/C11H9BrO3.C7H6O/c1-14-8-2-3-9-7(6-12)4-11(13)15-10(9)5-8;8-7-5-3-1-2-4-6-7/h2-5H,6H2,1H3;1-6H |
| InChIKey | HSZPWSZJOIMQFY-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.22 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|