C19H18F2NO3+ — CID 9375677
[(1S)-1-(3,4-difluorophenyl)ethyl]-[(7-methoxy-2-oxochromen-4-yl)methyl]azanium (PubChem CID 9375677) has the molecular formula C19H18F2NO3+ and a molecular weight of 346.35 g/mol. Its IUPAC name is [(1S)-1-(3,4-difluorophenyl)ethyl]-[(7-methoxy-2-oxochromen-4-yl)methyl]azanium.
| Compound Name | [(1S)-1-(3,4-difluorophenyl)ethyl]-[(7-methoxy-2-oxochromen-4-yl)methyl]azanium |
|---|---|
| PubChem CID | 9375677 |
| Molecular Formula | C19H18F2NO3+ |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | [(1S)-1-(3,4-difluorophenyl)ethyl]-[(7-methoxy-2-oxochromen-4-yl)methyl]azanium |
| SMILES | COc1ccc2c(C[NH2+][C@@H](C)c3ccc(F)c(F)c3)cc(=O)oc2c1 |
| InChI | InChI=1S/C19H17F2NO3/c1-11(12-3-6-16(20)17(21)7-12)22-10-13-8-19(23)25-18-9-14(24-2)4-5-15(13)18/h3-9,11,22H,10H2,1-2H3/p+1/t11-/m0/s1 |
| InChIKey | LKGBQKNVKRYUIQ-NSHDSACASA-O |
| XLogP | 2.90 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|