C19H17F2NO3 — CID 9368836
4-[[[(1S)-1-(2,4-difluorophenyl)ethyl]amino]methyl]-7-methoxychromen-2-one (PubChem CID 9368836) has the molecular formula C19H17F2NO3 and a molecular weight of 345.35 g/mol. Its IUPAC name is 4-[[[(1S)-1-(2,4-difluorophenyl)ethyl]amino]methyl]-7-methoxychromen-2-one.
| Compound Name | 4-[[[(1S)-1-(2,4-difluorophenyl)ethyl]amino]methyl]-7-methoxychromen-2-one |
|---|---|
| PubChem CID | 9368836 |
| Molecular Formula | C19H17F2NO3 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | 4-[[[(1S)-1-(2,4-difluorophenyl)ethyl]amino]methyl]-7-methoxychromen-2-one |
| SMILES | COc1ccc2c(CN[C@@H](C)c3ccc(F)cc3F)cc(=O)oc2c1 |
| InChI | InChI=1S/C19H17F2NO3/c1-11(15-5-3-13(20)8-17(15)21)22-10-12-7-19(23)25-18-9-14(24-2)4-6-16(12)18/h3-9,11,22H,10H2,1-2H3/t11-/m0/s1 |
| InChIKey | OSAUZZPLRIXKFL-NSHDSACASA-N |
| XLogP | 3.93 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|