C27H27NO5 — CID 31429535
4-[[[(1S)-1,2-bis(4-methoxyphenyl)ethyl]amino]methyl]-7-methoxychromen-2-one (PubChem CID 31429535) has the molecular formula C27H27NO5 and a molecular weight of 445.52 g/mol. Its IUPAC name is 4-[[[(1S)-1,2-bis(4-methoxyphenyl)ethyl]amino]methyl]-7-methoxychromen-2-one.
| Compound Name | 4-[[[(1S)-1,2-bis(4-methoxyphenyl)ethyl]amino]methyl]-7-methoxychromen-2-one |
|---|---|
| PubChem CID | 31429535 |
| Molecular Formula | C27H27NO5 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | 4-[[[(1S)-1,2-bis(4-methoxyphenyl)ethyl]amino]methyl]-7-methoxychromen-2-one |
| SMILES | COc1ccc(C[C@H](NCc2cc(=O)oc3cc(OC)ccc23)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C27H27NO5/c1-30-21-8-4-18(5-9-21)14-25(19-6-10-22(31-2)11-7-19)28-17-20-15-27(29)33-26-16-23(32-3)12-13-24(20)26/h4-13,15-16,25,28H,14,17H2,1-3H3/t25-/m0/s1 |
| InChIKey | ZYIHGLZFWPRXKQ-VWLOTQADSA-N |
| XLogP | 4.89 |
| TPSA | 69.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|