C15H13NO5 — CID 7819577
1-[(7-methoxy-2-oxochromen-4-yl)methyl]pyrrolidine-2,5-dione (PubChem CID 7819577) has the molecular formula C15H13NO5 and a molecular weight of 287.27 g/mol. Its IUPAC name is 1-[(7-methoxy-2-oxochromen-4-yl)methyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[(7-methoxy-2-oxochromen-4-yl)methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 7819577 |
| Molecular Formula | C15H13NO5 |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 1-[(7-methoxy-2-oxochromen-4-yl)methyl]pyrrolidine-2,5-dione |
| SMILES | COc1ccc2c(CN3C(=O)CCC3=O)cc(=O)oc2c1 |
| InChI | InChI=1S/C15H13NO5/c1-20-10-2-3-11-9(6-15(19)21-12(11)7-10)8-16-13(17)4-5-14(16)18/h2-3,6-7H,4-5,8H2,1H3 |
| InChIKey | SAOOTRHYIZTBIR-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|