C22H23NO5 — CID 8760387
4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-7-methoxychromen-2-one (PubChem CID 8760387) has the molecular formula C22H23NO5 and a molecular weight of 381.43 g/mol. Its IUPAC name is 4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-7-methoxychromen-2-one.
| Compound Name | 4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-7-methoxychromen-2-one |
|---|---|
| PubChem CID | 8760387 |
| Molecular Formula | C22H23NO5 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 4-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-7-methoxychromen-2-one |
| SMILES | COc1ccc2c(CN3CCc4cc(OC)c(OC)cc4C3)cc(=O)oc2c1 |
| InChI | InChI=1S/C22H23NO5/c1-25-17-4-5-18-16(10-22(24)28-19(18)11-17)13-23-7-6-14-8-20(26-2)21(27-3)9-15(14)12-23/h4-5,8-11H,6-7,12-13H2,1-3H3 |
| InChIKey | XRHRXBDQLFSPFT-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 61.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|