C24H27NO5 — CID 155511549
7-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethoxy]-3,4-dimethylchromen-2-one (PubChem CID 155511549) has the molecular formula C24H27NO5 and a molecular weight of 409.48 g/mol. Its IUPAC name is 7-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethoxy]-3,4-dimethylchromen-2-one.
| Compound Name | 7-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethoxy]-3,4-dimethylchromen-2-one |
|---|---|
| PubChem CID | 155511549 |
| Molecular Formula | C24H27NO5 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | 7-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethoxy]-3,4-dimethylchromen-2-one |
| SMILES | COc1cc2c(cc1OC)CN(CCOc1ccc3c(C)c(C)c(=O)oc3c1)CC2 |
| InChI | InChI=1S/C24H27NO5/c1-15-16(2)24(26)30-21-13-19(5-6-20(15)21)29-10-9-25-8-7-17-11-22(27-3)23(28-4)12-18(17)14-25/h5-6,11-13H,7-10,14H2,1-4H3 |
| InChIKey | LVTKYEDEEITQKT-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 61.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|