C31H33NO5 — CID 155529325
7-[[4-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenyl]methoxy]-3,4-dimethylchromen-2-one (PubChem CID 155529325) has the molecular formula C31H33NO5 and a molecular weight of 499.61 g/mol. Its IUPAC name is 7-[[4-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenyl]methoxy]-3,4-dimethylchromen-2-one.
| Compound Name | 7-[[4-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenyl]methoxy]-3,4-dimethylchromen-2-one |
|---|---|
| PubChem CID | 155529325 |
| Molecular Formula | C31H33NO5 |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.24 |
| IUPAC Name | 7-[[4-[2-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethyl]phenyl]methoxy]-3,4-dimethylchromen-2-one |
| SMILES | COc1cc2c(cc1OC)CN(CCc1ccc(COc3ccc4c(C)c(C)c(=O)oc4c3)cc1)CC2 |
| InChI | InChI=1S/C31H33NO5/c1-20-21(2)31(33)37-28-17-26(9-10-27(20)28)36-19-23-7-5-22(6-8-23)11-13-32-14-12-24-15-29(34-3)30(35-4)16-25(24)18-32/h5-10,15-17H,11-14,18-19H2,1-4H3 |
| InChIKey | BGWAMHCZOJDHAY-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 61.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|