C25H21NO7 — CID 44963500
3-(3,4-dimethoxyphenyl)-4-methyl-7-[(4-nitrophenyl)methoxy]chromen-2-one (PubChem CID 44963500) has the molecular formula C25H21NO7 and a molecular weight of 447.44 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-4-methyl-7-[(4-nitrophenyl)methoxy]chromen-2-one.
| Compound Name | 3-(3,4-dimethoxyphenyl)-4-methyl-7-[(4-nitrophenyl)methoxy]chromen-2-one |
|---|---|
| PubChem CID | 44963500 |
| Molecular Formula | C25H21NO7 |
| Molecular Weight | 447.44 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-4-methyl-7-[(4-nitrophenyl)methoxy]chromen-2-one |
| SMILES | COc1ccc(-c2c(C)c3ccc(OCc4ccc([N+](=O)[O-])cc4)cc3oc2=O)cc1OC |
| InChI | InChI=1S/C25H21NO7/c1-15-20-10-9-19(32-14-16-4-7-18(8-5-16)26(28)29)13-22(20)33-25(27)24(15)17-6-11-21(30-2)23(12-17)31-3/h4-13H,14H2,1-3H3 |
| InChIKey | JRJQQJSQLRYLHL-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 101.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.44 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|