C25H20Cl2O5 — CID 44963449
7-[(2,4-dichlorophenyl)methoxy]-3-(3,4-dimethoxyphenyl)-4-methylchromen-2-one (PubChem CID 44963449) has the molecular formula C25H20Cl2O5 and a molecular weight of 471.34 g/mol. Its IUPAC name is 7-[(2,4-dichlorophenyl)methoxy]-3-(3,4-dimethoxyphenyl)-4-methylchromen-2-one.
| Compound Name | 7-[(2,4-dichlorophenyl)methoxy]-3-(3,4-dimethoxyphenyl)-4-methylchromen-2-one |
|---|---|
| PubChem CID | 44963449 |
| Molecular Formula | C25H20Cl2O5 |
| Molecular Weight | 471.34 g/mol |
| Exact Mass | 470.07 |
| IUPAC Name | 7-[(2,4-dichlorophenyl)methoxy]-3-(3,4-dimethoxyphenyl)-4-methylchromen-2-one |
| SMILES | COc1ccc(-c2c(C)c3ccc(OCc4ccc(Cl)cc4Cl)cc3oc2=O)cc1OC |
| InChI | InChI=1S/C25H20Cl2O5/c1-14-19-8-7-18(31-13-16-4-6-17(26)11-20(16)27)12-22(19)32-25(28)24(14)15-5-9-21(29-2)23(10-15)30-3/h4-12H,13H2,1-3H3 |
| InChIKey | CVCVPCCYLIXSLI-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.34 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|