C17H12Cl2O3 — CID 2372490
3-(3,4-dichlorophenyl)-7-methoxy-4-methylchromen-2-one (PubChem CID 2372490) has the molecular formula C17H12Cl2O3 and a molecular weight of 335.19 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-7-methoxy-4-methylchromen-2-one.
| Compound Name | 3-(3,4-dichlorophenyl)-7-methoxy-4-methylchromen-2-one |
|---|---|
| PubChem CID | 2372490 |
| Molecular Formula | C17H12Cl2O3 |
| Molecular Weight | 335.19 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-7-methoxy-4-methylchromen-2-one |
| SMILES | COc1ccc2c(C)c(-c3ccc(Cl)c(Cl)c3)c(=O)oc2c1 |
| InChI | InChI=1S/C17H12Cl2O3/c1-9-12-5-4-11(21-2)8-15(12)22-17(20)16(9)10-3-6-13(18)14(19)7-10/h3-8H,1-2H3 |
| InChIKey | RYYUCFWLWISLGI-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.19 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|