C26H21ClO6 — CID 44963485
7-[2-(4-chlorophenyl)-2-oxoethoxy]-3-(3,4-dimethoxyphenyl)-4-methylchromen-2-one (PubChem CID 44963485) has the molecular formula C26H21ClO6 and a molecular weight of 464.90 g/mol. Its IUPAC name is 7-[2-(4-chlorophenyl)-2-oxoethoxy]-3-(3,4-dimethoxyphenyl)-4-methylchromen-2-one.
| Compound Name | 7-[2-(4-chlorophenyl)-2-oxoethoxy]-3-(3,4-dimethoxyphenyl)-4-methylchromen-2-one |
|---|---|
| PubChem CID | 44963485 |
| Molecular Formula | C26H21ClO6 |
| Molecular Weight | 464.90 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | 7-[2-(4-chlorophenyl)-2-oxoethoxy]-3-(3,4-dimethoxyphenyl)-4-methylchromen-2-one |
| SMILES | COc1ccc(-c2c(C)c3ccc(OCC(=O)c4ccc(Cl)cc4)cc3oc2=O)cc1OC |
| InChI | InChI=1S/C26H21ClO6/c1-15-20-10-9-19(32-14-21(28)16-4-7-18(27)8-5-16)13-23(20)33-26(29)25(15)17-6-11-22(30-2)24(12-17)31-3/h4-13H,14H2,1-3H3 |
| InChIKey | ZRMLRAIPNICINR-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.90 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|