C27H24O7 — CID 44963701
benzyl 2-[3-(3,4-dimethoxyphenyl)-4-methyl-2-oxochromen-7-yl]oxyacetate (PubChem CID 44963701) has the molecular formula C27H24O7 and a molecular weight of 460.48 g/mol. Its IUPAC name is benzyl 2-[3-(3,4-dimethoxyphenyl)-4-methyl-2-oxochromen-7-yl]oxyacetate.
| Compound Name | benzyl 2-[3-(3,4-dimethoxyphenyl)-4-methyl-2-oxochromen-7-yl]oxyacetate |
|---|---|
| PubChem CID | 44963701 |
| Molecular Formula | C27H24O7 |
| Molecular Weight | 460.48 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | benzyl 2-[3-(3,4-dimethoxyphenyl)-4-methyl-2-oxochromen-7-yl]oxyacetate |
| SMILES | COc1ccc(-c2c(C)c3ccc(OCC(=O)OCc4ccccc4)cc3oc2=O)cc1OC |
| InChI | InChI=1S/C27H24O7/c1-17-21-11-10-20(32-16-25(28)33-15-18-7-5-4-6-8-18)14-23(21)34-27(29)26(17)19-9-12-22(30-2)24(13-19)31-3/h4-14H,15-16H2,1-3H3 |
| InChIKey | WZQLPUYURXVXCC-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 84.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.48 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|