C26H17F5O7 — CID 95397915
[3-(3,4-dimethoxyphenyl)-4-methyl-2-oxochromen-6-yl] 2-(2,3,4,5,6-pentafluorophenoxy)acetate (PubChem CID 95397915) has the molecular formula C26H17F5O7 and a molecular weight of 536.41 g/mol. Its IUPAC name is [3-(3,4-dimethoxyphenyl)-4-methyl-2-oxochromen-6-yl] 2-(2,3,4,5,6-pentafluorophenoxy)acetate.
| Compound Name | [3-(3,4-dimethoxyphenyl)-4-methyl-2-oxochromen-6-yl] 2-(2,3,4,5,6-pentafluorophenoxy)acetate |
|---|---|
| PubChem CID | 95397915 |
| Molecular Formula | C26H17F5O7 |
| Molecular Weight | 536.41 g/mol |
| Exact Mass | 536.09 |
| IUPAC Name | [3-(3,4-dimethoxyphenyl)-4-methyl-2-oxochromen-6-yl] 2-(2,3,4,5,6-pentafluorophenoxy)acetate |
| SMILES | COc1ccc(-c2c(C)c3cc(OC(=O)COc4c(F)c(F)c(F)c(F)c4F)ccc3oc2=O)cc1OC |
| InChI | InChI=1S/C26H17F5O7/c1-11-14-9-13(37-18(32)10-36-25-23(30)21(28)20(27)22(29)24(25)31)5-7-15(14)38-26(33)19(11)12-4-6-16(34-2)17(8-12)35-3/h4-9H,10H2,1-3H3 |
| InChIKey | ZPKGXYJBZBUJMP-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 84.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.41 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|