C27H19F5O8 — CID 95397825
[(2Z)-7-methyl-3-oxo-2-[(2,4,5-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl] 2-(2,3,4,5,6-pentafluorophenoxy)acetate (PubChem CID 95397825) has the molecular formula C27H19F5O8 and a molecular weight of 566.43 g/mol. Its IUPAC name is [(2Z)-7-methyl-3-oxo-2-[(2,4,5-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl] 2-(2,3,4,5,6-pentafluorophenoxy)acetate.
| Compound Name | [(2Z)-7-methyl-3-oxo-2-[(2,4,5-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl] 2-(2,3,4,5,6-pentafluorophenoxy)acetate |
|---|---|
| PubChem CID | 95397825 |
| Molecular Formula | C27H19F5O8 |
| Molecular Weight | 566.43 g/mol |
| Exact Mass | 566.10 |
| IUPAC Name | [(2Z)-7-methyl-3-oxo-2-[(2,4,5-trimethoxyphenyl)methylidene]-1-benzofuran-6-yl] 2-(2,3,4,5,6-pentafluorophenoxy)acetate |
| SMILES | COc1cc(OC)c(OC)cc1/C=C1\Oc2c(ccc(OC(=O)COc3c(F)c(F)c(F)c(F)c3F)c2C)C1=O |
| InChI | InChI=1S/C27H19F5O8/c1-11-14(39-19(33)10-38-27-23(31)21(29)20(28)22(30)24(27)32)6-5-13-25(34)18(40-26(11)13)8-12-7-16(36-3)17(37-4)9-15(12)35-2/h5-9H,10H2,1-4H3/b18-8- |
| InChIKey | HZVVTEVHPTTYGS-LSCVHKIXSA-N |
| XLogP | 5.32 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.43 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|